|
831) |
|
Nyoman Rupiasih, N., Aher, A., Gosavi, S., Vidyasagar, P.B. (2013,January, 24-25). Green synthesis of silver nanoparticles using latex extract of Thevetia peruviana: A novel approach towards poisonous plant utilization. Proceedings of Science and Engineering in Mathematics, Chemistry and Physics, ScieTech 2013.
Jakarta; Indonesia: Institute of Physics Publishing.
ISBN: 1742-6588.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
832) |
|
Kapadnis, R.S., Bansode, S.B., Kale, S.S., Pathan, H.M. (2013,February, 1-2). Growth of polycrystalline oxygenated three dimensional cadmium telluride thin films by chemical synthesis. In S. Bhardwaj(Eds.), Proceedings of Recent Trends in Applied Physics and Material Science(pp.451-452).
Rajasthan; India: American Institute of Physics Inc.
ISBN: 9780735411609/0094-243X.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
833) |
|
Kumar, R., Agarwal, R., Nandi, S. (2013,December, 27-30). Hydrodynamic Behavior of Internal Loop Airlift Reactor. In G.D. Yadav(Ed.), Proceedings of Proceedings of 66th Annual Chemical Engineering Congress (CHEMCON)(pp.202).
Mumbai; India: UICT, Mumbai and IIChE Mumbai Regional Center.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
834) |
|
Salunke, K., Jadhav, V. (2013,December, 2-6). ICT in ODL: Mobile Learning for Inclusive Education. Proceedings of Seventh Pan-Commonwealth Forum on Open Learning (PCF7).
Nigeria: Commonwealth of Learning.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
835) |
|
Chougule, S.N., Dhumaland, K.N., Rajurkar, N.S. (2013,November, 28-30). Impact of environmental factors on mineral contents of nothapodites nimmoniana growing in western ghats. Proceedings of Current Trends in Science and Technology.
Pune; India: Env. Observer.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
836) |
|
Moshayedi, A.J., Gharpure, D.C. (2013,December, 26-28). Implementing breath to improve response of gas sensors for leak detection in plume tracker robots. In K. Deep(Eds.), Proceedings of 3rd International Conference on Soft Computing for Problem Solving, SocProS 2013(pp.337-348).
Roorkee; India: Springer .
ISBN: 9788132217671/2194-5357.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
837) |
|
Arjunwadkar, M., Mitra, D., Rankin, J. (2013,December, 9-13). Inferring a characteristic timescale for pulsarmicrostructure. In J.N. Chengalur(Eds.), Proceedings of Astronomical Society of India Conference Series: Proceedings of the Metrewavelength Sky(pp.83-85).
Pune; India: Bulletin of the Astronomical Society of India.
ISBN: 9788193528501.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
838) |
|
Arjunwadkar, M., Rajwade, K., Gupta, Y. (2013,December, 9-13). Inferring pulsar null fraction using Gaussian mixtures. In J.N. Chengalur(Eds.), Proceedings of Astronomical Society of India Conference Series: Proceedings of the Metrewavelength Sky (pp.79-81).
Pune; India: Bulletin of the Astronomical Society of India.
ISBN: 9788193528501.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
839) |
|
Yadwadkar, A.S. (2013,January, 4-5). Inflation In India: Challenges Ahead. Proceedings of Advances in Research in Commerce and Economics: Innovations, Statistical Applications and Publications(pp.101-104).
Pune; India.
ISBN: 9878192578200.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
840) |
|
Londhe, P.U., More, M., Chaure, N.B. (2013,July, 24-26). Influence of capping agents on the growth of gold nanoparticles from aqueous and non-aqueous medium. Proceedings of Advanced Nanomaterials and Emerging Engineering Technologies(pp.317-319).
Chennai; India: IEEE Xplore Digital Library.
ISBN: 9781479913794.
|
|
| |
| |
| |
| |
| |
| |
| |
| |