|
851) |
|
Moshayedi, A.J., Gharpure, D.C. (2013,December, 26-28). Implementing breath to improve response of gas sensors for leak detection in plume tracker robots. In K. Deep(Eds.), Proceedings of 3rd International Conference on Soft Computing for Problem Solving, SocProS 2013(pp.337-348).
Roorkee; India: Springer .
ISBN: 9788132217671/2194-5357.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
852) |
|
Arjunwadkar, M., Mitra, D., Rankin, J. (2013,December, 9-13). Inferring a characteristic timescale for pulsarmicrostructure. In J.N. Chengalur(Eds.), Proceedings of Astronomical Society of India Conference Series: Proceedings of the Metrewavelength Sky(pp.83-85).
Pune; India: Bulletin of the Astronomical Society of India.
ISBN: 9788193528501.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
853) |
|
Arjunwadkar, M., Rajwade, K., Gupta, Y. (2013,December, 9-13). Inferring pulsar null fraction using Gaussian mixtures. In J.N. Chengalur(Eds.), Proceedings of Astronomical Society of India Conference Series: Proceedings of the Metrewavelength Sky (pp.79-81).
Pune; India: Bulletin of the Astronomical Society of India.
ISBN: 9788193528501.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
854) |
|
Yadwadkar, A.S. (2013,January, 4-5). Inflation In India: Challenges Ahead. Proceedings of Advances in Research in Commerce and Economics: Innovations, Statistical Applications and Publications(pp.101-104).
Pune; India.
ISBN: 9878192578200.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
855) |
|
Londhe, P.U., More, M., Chaure, N.B. (2013,July, 24-26). Influence of capping agents on the growth of gold nanoparticles from aqueous and non-aqueous medium. Proceedings of Advanced Nanomaterials and Emerging Engineering Technologies(pp.317-319).
Chennai; India: IEEE Xplore Digital Library.
ISBN: 9781479913794.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
856) |
|
Mandal, A., Shinde, S.D., Adhi, K.P., Adhi, S.K. (2013,February, 22-23). Influence of oxygen atmosphere on pure and europium doped zinc oxide thin films by pulsed laser deposition. Proceedings of Raman Memorial Conference.
Savitribai Phule Pune University; India.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
857) |
|
Mandal, A., Shinde, S.D., Adhi, K.P., Adhi, S.K. (2013,Janaury, 31-February, 2 ). Influence of oxygen variation on Europium Doped Zinc Oxide Thin Films grown by Pulsed Laser Deposition. Proceedings of National Conference on Functional Nanomaterials: Synthesis, Characterization and Application.
Pune; India: Savitribai Phule Pune University.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
858) |
|
Shinde, S. (2013,January, 5 ). Information literacy: librarians' role in information literacy programmes. In S. Kamble(Eds.), Proceedings of Information literacy in academic libraries in digital era(pp.151-156).
Nagpur, India: Sai Jyoti Publication.
ISBN: 9789381432372.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
859) |
|
Murari, D., Nagarkar, S.P. (2013,August, 17-23). Information Needs of Women Entrepreneurs in Pune city. Proceedings of IFLA World Library and Information Congress.
Singapore: International Federation of Library Associations and Institutions.
|
|
| |
| |
| |
| |
| |
| |
| |
| |
|
860) |
|
Wadekar, P.P., Deshpande, N.J. (2013,March, 13-15). Information retrieval from online databases subscribed by Jayakar Library, University of Pune . Proceedings of International conference on electronic publishing.
Pune; India: University of Pune.
|
|
| |
| |
| |
| |
| |
| |
| |
| |